C19H23N3O4 — CID 55535244
N-[2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl]-N-methylfuran-2-carboxamide (PubChem CID 55535244) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is N-[2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl]-N-methylfuran-2-carboxamide.
| Compound Name | N-[2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl]-N-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 55535244 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | N-[2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl]-N-methylfuran-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)CN(C)C(=O)c2ccco2)c1 |
| InChI | InChI=1S/C19H23N3O4/c1-4-22(5-2)18(24)14-8-6-9-15(12-14)20-17(23)13-21(3)19(25)16-10-7-11-26-16/h6-12H,4-5,13H2,1-3H3,(H,20,23) |
| InChIKey | OVHYDGFJZXWVGH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |