C17H26ClN3O4 — CID 119913546
2-[[2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl]-methylamino]propanoic acid;hydrochloride (PubChem CID 119913546) has the molecular formula C17H26ClN3O4 and a molecular weight of 371.87 g/mol. Its IUPAC name is 2-[[2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl]-methylamino]propanoic acid;hydrochloride.
| Compound Name | 2-[[2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl]-methylamino]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 119913546 |
| Molecular Formula | C17H26ClN3O4 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 2-[[2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl]-methylamino]propanoic acid;hydrochloride |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)CN(C)C(C)C(=O)O)c1.Cl |
| InChI | InChI=1S/C17H25N3O4.ClH/c1-5-20(6-2)16(22)13-8-7-9-14(10-13)18-15(21)11-19(4)12(3)17(23)24;/h7-10,12H,5-6,11H2,1-4H3,(H,18,21)(H,23,24);1H |
| InChIKey | VEFVDQWDCNWJSV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |