C16H21N2O3S2+ — CID 8804558
methyl-[2-(3-methylsulfonylanilino)-2-oxoethyl]-[(3-methylthiophen-2-yl)methyl]azanium (PubChem CID 8804558) has the molecular formula C16H21N2O3S2+ and a molecular weight of 353.49 g/mol. Its IUPAC name is methyl-[2-(3-methylsulfonylanilino)-2-oxoethyl]-[(3-methylthiophen-2-yl)methyl]azanium.
| Compound Name | methyl-[2-(3-methylsulfonylanilino)-2-oxoethyl]-[(3-methylthiophen-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 8804558 |
| Molecular Formula | C16H21N2O3S2+ |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | methyl-[2-(3-methylsulfonylanilino)-2-oxoethyl]-[(3-methylthiophen-2-yl)methyl]azanium |
| SMILES | Cc1ccsc1C[NH+](C)CC(=O)Nc1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C16H20N2O3S2/c1-12-7-8-22-15(12)10-18(2)11-16(19)17-13-5-4-6-14(9-13)23(3,20)21/h4-9H,10-11H2,1-3H3,(H,17,19)/p+1 |
| InChIKey | CNFRLISKSGSTES-UHFFFAOYSA-O |
| XLogP | 1.11 |
| TPSA | 67.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |