C16H21N2O4S+ — CID 8810381
methyl-[(5-methylfuran-2-yl)methyl]-[2-(3-methylsulfonylanilino)-2-oxoethyl]azanium (PubChem CID 8810381) has the molecular formula C16H21N2O4S+ and a molecular weight of 337.42 g/mol. Its IUPAC name is methyl-[(5-methylfuran-2-yl)methyl]-[2-(3-methylsulfonylanilino)-2-oxoethyl]azanium.
| Compound Name | methyl-[(5-methylfuran-2-yl)methyl]-[2-(3-methylsulfonylanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8810381 |
| Molecular Formula | C16H21N2O4S+ |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | methyl-[(5-methylfuran-2-yl)methyl]-[2-(3-methylsulfonylanilino)-2-oxoethyl]azanium |
| SMILES | Cc1ccc(C[NH+](C)CC(=O)Nc2cccc(S(C)(=O)=O)c2)o1 |
| InChI | InChI=1S/C16H20N2O4S/c1-12-7-8-14(22-12)10-18(2)11-16(19)17-13-5-4-6-15(9-13)23(3,20)21/h4-9H,10-11H2,1-3H3,(H,17,19)/p+1 |
| InChIKey | UIONJWUYJVZODB-UHFFFAOYSA-O |
| XLogP | 0.64 |
| TPSA | 80.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |