C15H15NO4S — CID 27334787
(E)-3-(5-methylfuran-2-yl)-N-(3-methylsulfonylphenyl)prop-2-enamide (PubChem CID 27334787) has the molecular formula C15H15NO4S and a molecular weight of 305.36 g/mol. Its IUPAC name is (E)-3-(5-methylfuran-2-yl)-N-(3-methylsulfonylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(5-methylfuran-2-yl)-N-(3-methylsulfonylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 27334787 |
| Molecular Formula | C15H15NO4S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | (E)-3-(5-methylfuran-2-yl)-N-(3-methylsulfonylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(=O)Nc2cccc(S(C)(=O)=O)c2)o1 |
| InChI | InChI=1S/C15H15NO4S/c1-11-6-7-13(20-11)8-9-15(17)16-12-4-3-5-14(10-12)21(2,18)19/h3-10H,1-2H3,(H,16,17)/b9-8+ |
| InChIKey | YXDJIQMGGIOIBY-CMDGGOBGSA-N |
| XLogP | 2.64 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|