C21H19N3O3 — CID 24632271
(E)-3-(5-methylfuran-2-yl)-N-[3-(phenylcarbamoylamino)phenyl]prop-2-enamide (PubChem CID 24632271) has the molecular formula C21H19N3O3 and a molecular weight of 361.40 g/mol. Its IUPAC name is (E)-3-(5-methylfuran-2-yl)-N-[3-(phenylcarbamoylamino)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(5-methylfuran-2-yl)-N-[3-(phenylcarbamoylamino)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 24632271 |
| Molecular Formula | C21H19N3O3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | (E)-3-(5-methylfuran-2-yl)-N-[3-(phenylcarbamoylamino)phenyl]prop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(=O)Nc2cccc(NC(=O)Nc3ccccc3)c2)o1 |
| InChI | InChI=1S/C21H19N3O3/c1-15-10-11-19(27-15)12-13-20(25)22-17-8-5-9-18(14-17)24-21(26)23-16-6-3-2-4-7-16/h2-14H,1H3,(H,22,25)(H2,23,24,26)/b13-12+ |
| InChIKey | BCPXFSGIMSWUOR-OUKQBFOZSA-N |
| XLogP | 4.88 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|