C24H20N2O5 — CID 50846758
3-methoxy-5-[[(E)-3-(5-methylfuran-2-yl)prop-2-enoyl]amino]-N-phenyl-1-benzofuran-2-carboxamide (PubChem CID 50846758) has the molecular formula C24H20N2O5 and a molecular weight of 416.43 g/mol. Its IUPAC name is 3-methoxy-5-[[(E)-3-(5-methylfuran-2-yl)prop-2-enoyl]amino]-N-phenyl-1-benzofuran-2-carboxamide.
| Compound Name | 3-methoxy-5-[[(E)-3-(5-methylfuran-2-yl)prop-2-enoyl]amino]-N-phenyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 50846758 |
| Molecular Formula | C24H20N2O5 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 3-methoxy-5-[[(E)-3-(5-methylfuran-2-yl)prop-2-enoyl]amino]-N-phenyl-1-benzofuran-2-carboxamide |
| SMILES | COc1c(C(=O)Nc2ccccc2)oc2ccc(NC(=O)/C=C/c3ccc(C)o3)cc12 |
| InChI | InChI=1S/C24H20N2O5/c1-15-8-10-18(30-15)11-13-21(27)25-17-9-12-20-19(14-17)22(29-2)23(31-20)24(28)26-16-6-4-3-5-7-16/h3-14H,1-2H3,(H,25,27)(H,26,28)/b13-11+ |
| InChIKey | ICLSMCGEXXZFRS-ACCUITESSA-N |
| XLogP | 5.25 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|