C16H18F3N2O3+ — CID 9102772
methyl-[(5-methylfuran-2-yl)methyl]-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]azanium (PubChem CID 9102772) has the molecular formula C16H18F3N2O3+ and a molecular weight of 343.33 g/mol. Its IUPAC name is methyl-[(5-methylfuran-2-yl)methyl]-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]azanium.
| Compound Name | methyl-[(5-methylfuran-2-yl)methyl]-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]azanium |
|---|---|
| PubChem CID | 9102772 |
| Molecular Formula | C16H18F3N2O3+ |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | methyl-[(5-methylfuran-2-yl)methyl]-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]azanium |
| SMILES | Cc1ccc(C[NH+](C)CC(=O)Nc2ccc(OC(F)(F)F)cc2)o1 |
| InChI | InChI=1S/C16H17F3N2O3/c1-11-3-6-14(23-11)9-21(2)10-15(22)20-12-4-7-13(8-5-12)24-16(17,18)19/h3-8H,9-10H2,1-2H3,(H,20,22)/p+1 |
| InChIKey | ZRTKZBCCSJSYBO-UHFFFAOYSA-O |
| XLogP | 2.14 |
| TPSA | 55.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |