C16H23F3N3O3+ — CID 9366798
[2-(diethylamino)-2-oxoethyl]-methyl-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]azanium (PubChem CID 9366798) has the molecular formula C16H23F3N3O3+ and a molecular weight of 362.37 g/mol. Its IUPAC name is [2-(diethylamino)-2-oxoethyl]-methyl-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]azanium.
| Compound Name | [2-(diethylamino)-2-oxoethyl]-methyl-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]azanium |
|---|---|
| PubChem CID | 9366798 |
| Molecular Formula | C16H23F3N3O3+ |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | [2-(diethylamino)-2-oxoethyl]-methyl-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]azanium |
| SMILES | CCN(CC)C(=O)C[NH+](C)CC(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H22F3N3O3/c1-4-22(5-2)15(24)11-21(3)10-14(23)20-12-6-8-13(9-7-12)25-16(17,18)19/h6-9H,4-5,10-11H2,1-3H3,(H,20,23)/p+1 |
| InChIKey | NMVAMTHJNSSEEB-UHFFFAOYSA-O |
| XLogP | 0.91 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |