C18H19F3N3O3+ — CID 9366572
(2-anilino-2-oxoethyl)-methyl-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]azanium (PubChem CID 9366572) has the molecular formula C18H19F3N3O3+ and a molecular weight of 382.36 g/mol. Its IUPAC name is (2-anilino-2-oxoethyl)-methyl-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]azanium.
| Compound Name | (2-anilino-2-oxoethyl)-methyl-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]azanium |
|---|---|
| PubChem CID | 9366572 |
| Molecular Formula | C18H19F3N3O3+ |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | (2-anilino-2-oxoethyl)-methyl-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]azanium |
| SMILES | C[NH+](CC(=O)Nc1ccccc1)CC(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H18F3N3O3/c1-24(11-16(25)22-13-5-3-2-4-6-13)12-17(26)23-14-7-9-15(10-8-14)27-18(19,20)21/h2-10H,11-12H2,1H3,(H,22,25)(H,23,26)/p+1 |
| InChIKey | UNWMIOUFQDXGLS-UHFFFAOYSA-O |
| XLogP | 1.68 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |