C19H27F3N3O3+ — CID 8642357
[2-(azocan-1-yl)-2-oxoethyl]-methyl-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]azanium (PubChem CID 8642357) has the molecular formula C19H27F3N3O3+ and a molecular weight of 402.44 g/mol. Its IUPAC name is [2-(azocan-1-yl)-2-oxoethyl]-methyl-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]azanium.
| Compound Name | [2-(azocan-1-yl)-2-oxoethyl]-methyl-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]azanium |
|---|---|
| PubChem CID | 8642357 |
| Molecular Formula | C19H27F3N3O3+ |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | [2-(azocan-1-yl)-2-oxoethyl]-methyl-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]azanium |
| SMILES | C[NH+](CC(=O)Nc1ccc(OC(F)(F)F)cc1)CC(=O)N1CCCCCCC1 |
| InChI | InChI=1S/C19H26F3N3O3/c1-24(14-18(27)25-11-5-3-2-4-6-12-25)13-17(26)23-15-7-9-16(10-8-15)28-19(20,21)22/h7-10H,2-6,11-14H2,1H3,(H,23,26)/p+1 |
| InChIKey | JVPSMWRVPURSPS-UHFFFAOYSA-O |
| XLogP | 1.83 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |