C19H25ClN2O5S — CID 32992438
4-chloro-3-(diethylsulfamoyl)-N-(furan-2-ylmethyl)-N-(2-methoxyethyl)benzamide (PubChem CID 32992438) has the molecular formula C19H25ClN2O5S and a molecular weight of 428.94 g/mol. Its IUPAC name is 4-chloro-3-(diethylsulfamoyl)-N-(furan-2-ylmethyl)-N-(2-methoxyethyl)benzamide.
| Compound Name | 4-chloro-3-(diethylsulfamoyl)-N-(furan-2-ylmethyl)-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 32992438 |
| Molecular Formula | C19H25ClN2O5S |
| Molecular Weight | 428.94 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 4-chloro-3-(diethylsulfamoyl)-N-(furan-2-ylmethyl)-N-(2-methoxyethyl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)N(CCOC)Cc2ccco2)ccc1Cl |
| InChI | InChI=1S/C19H25ClN2O5S/c1-4-22(5-2)28(24,25)18-13-15(8-9-17(18)20)19(23)21(10-12-26-3)14-16-7-6-11-27-16/h6-9,11,13H,4-5,10,12,14H2,1-3H3 |
| InChIKey | PVDCBFSMBXGIPS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.94 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |