C16H19N3O4 — CID 32993957
4-(carbamoylamino)-N-(furan-2-ylmethyl)-N-(2-methoxyethyl)benzamide (PubChem CID 32993957) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is 4-(carbamoylamino)-N-(furan-2-ylmethyl)-N-(2-methoxyethyl)benzamide.
| Compound Name | 4-(carbamoylamino)-N-(furan-2-ylmethyl)-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 32993957 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 4-(carbamoylamino)-N-(furan-2-ylmethyl)-N-(2-methoxyethyl)benzamide |
| SMILES | COCCN(Cc1ccco1)C(=O)c1ccc(NC(N)=O)cc1 |
| InChI | InChI=1S/C16H19N3O4/c1-22-10-8-19(11-14-3-2-9-23-14)15(20)12-4-6-13(7-5-12)18-16(17)21/h2-7,9H,8,10-11H2,1H3,(H3,17,18,21) |
| InChIKey | WBLKKHJZJARHCD-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |