C15H17N3O2S — CID 19649192
N-[4-(furan-2-ylmethylcarbamothioylamino)phenyl]-N-methylacetamide (PubChem CID 19649192) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is N-[4-(furan-2-ylmethylcarbamothioylamino)phenyl]-N-methylacetamide.
| Compound Name | N-[4-(furan-2-ylmethylcarbamothioylamino)phenyl]-N-methylacetamide |
|---|---|
| PubChem CID | 19649192 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | N-[4-(furan-2-ylmethylcarbamothioylamino)phenyl]-N-methylacetamide |
| SMILES | CC(=O)N(C)c1ccc(NC(=S)NCc2ccco2)cc1 |
| InChI | InChI=1S/C15H17N3O2S/c1-11(19)18(2)13-7-5-12(6-8-13)17-15(21)16-10-14-4-3-9-20-14/h3-9H,10H2,1-2H3,(H2,16,17,21) |
| InChIKey | DYEATPGLBCWYAU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|