C15H15N3O3S — CID 8563698
1-(furan-2-ylmethyl)-3-[(2S)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]thiourea (PubChem CID 8563698) has the molecular formula C15H15N3O3S and a molecular weight of 317.37 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-[(2S)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]thiourea.
| Compound Name | 1-(furan-2-ylmethyl)-3-[(2S)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]thiourea |
|---|---|
| PubChem CID | 8563698 |
| Molecular Formula | C15H15N3O3S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-[(2S)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]thiourea |
| SMILES | C[C@@H]1Oc2ccc(NC(=S)NCc3ccco3)cc2NC1=O |
| InChI | InChI=1S/C15H15N3O3S/c1-9-14(19)18-12-7-10(4-5-13(12)21-9)17-15(22)16-8-11-3-2-6-20-11/h2-7,9H,8H2,1H3,(H,18,19)(H2,16,17,22)/t9-/m0/s1 |
| InChIKey | FNMGHTANLWCJMZ-VIFPVBQESA-N |
| XLogP | 2.49 |
| TPSA | 75.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|