C16H19N3O5S — CID 18118985
4-(dimethylsulfamoyl)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]benzamide (PubChem CID 18118985) has the molecular formula C16H19N3O5S and a molecular weight of 365.41 g/mol. Its IUPAC name is 4-(dimethylsulfamoyl)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]benzamide.
| Compound Name | 4-(dimethylsulfamoyl)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 18118985 |
| Molecular Formula | C16H19N3O5S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 4-(dimethylsulfamoyl)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]benzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)NCC(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C16H19N3O5S/c1-19(2)25(22,23)14-7-5-12(6-8-14)16(21)18-11-15(20)17-10-13-4-3-9-24-13/h3-9H,10-11H2,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | KLEUONRVJHYFMT-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |