C17H23N3O4S — CID 109060283
4-[3-(dimethylamino)propylsulfamoyl]-N-(furan-2-ylmethyl)benzamide (PubChem CID 109060283) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is 4-[3-(dimethylamino)propylsulfamoyl]-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 4-[3-(dimethylamino)propylsulfamoyl]-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 109060283 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 4-[3-(dimethylamino)propylsulfamoyl]-N-(furan-2-ylmethyl)benzamide |
| SMILES | CN(C)CCCNS(=O)(=O)c1ccc(C(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C17H23N3O4S/c1-20(2)11-4-10-19-25(22,23)16-8-6-14(7-9-16)17(21)18-13-15-5-3-12-24-15/h3,5-9,12,19H,4,10-11,13H2,1-2H3,(H,18,21) |
| InChIKey | MFRYVLDWEKXMOV-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|