C15H21N5O2 — CID 109253483
2-[3-(dimethylamino)propylamino]-N-(furan-2-ylmethyl)pyrimidine-5-carboxamide (PubChem CID 109253483) has the molecular formula C15H21N5O2 and a molecular weight of 303.37 g/mol. Its IUPAC name is 2-[3-(dimethylamino)propylamino]-N-(furan-2-ylmethyl)pyrimidine-5-carboxamide.
| Compound Name | 2-[3-(dimethylamino)propylamino]-N-(furan-2-ylmethyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109253483 |
| Molecular Formula | C15H21N5O2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 2-[3-(dimethylamino)propylamino]-N-(furan-2-ylmethyl)pyrimidine-5-carboxamide |
| SMILES | CN(C)CCCNc1ncc(C(=O)NCc2ccco2)cn1 |
| InChI | InChI=1S/C15H21N5O2/c1-20(2)7-4-6-16-15-18-9-12(10-19-15)14(21)17-11-13-5-3-8-22-13/h3,5,8-10H,4,6-7,11H2,1-2H3,(H,17,21)(H,16,18,19) |
| InChIKey | ZBMYEMZWJXUJNT-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 83.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|