C15H19N4O3S+ — CID 8683380
[(1R)-1-(furan-2-yl)-2-[(4-nitrophenyl)carbamothioylamino]ethyl]-dimethylazanium (PubChem CID 8683380) has the molecular formula C15H19N4O3S+ and a molecular weight of 335.41 g/mol. Its IUPAC name is [(1R)-1-(furan-2-yl)-2-[(4-nitrophenyl)carbamothioylamino]ethyl]-dimethylazanium.
| Compound Name | [(1R)-1-(furan-2-yl)-2-[(4-nitrophenyl)carbamothioylamino]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 8683380 |
| Molecular Formula | C15H19N4O3S+ |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | [(1R)-1-(furan-2-yl)-2-[(4-nitrophenyl)carbamothioylamino]ethyl]-dimethylazanium |
| SMILES | C[NH+](C)[C@H](CNC(=S)Nc1ccc([N+](=O)[O-])cc1)c1ccco1 |
| InChI | InChI=1S/C15H18N4O3S/c1-18(2)13(14-4-3-9-22-14)10-16-15(23)17-11-5-7-12(8-6-11)19(20)21/h3-9,13H,10H2,1-2H3,(H2,16,17,23)/p+1/t13-/m1/s1 |
| InChIKey | NLIWZWMNYDLEIZ-CYBMUJFWSA-O |
| XLogP | 1.36 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|