C15H19N4O2S2+ — CID 8684336
dimethyl-[(1S)-2-[(4-nitrophenyl)carbamothioylamino]-1-thiophen-2-ylethyl]azanium (PubChem CID 8684336) has the molecular formula C15H19N4O2S2+ and a molecular weight of 351.48 g/mol. Its IUPAC name is dimethyl-[(1S)-2-[(4-nitrophenyl)carbamothioylamino]-1-thiophen-2-ylethyl]azanium.
| Compound Name | dimethyl-[(1S)-2-[(4-nitrophenyl)carbamothioylamino]-1-thiophen-2-ylethyl]azanium |
|---|---|
| PubChem CID | 8684336 |
| Molecular Formula | C15H19N4O2S2+ |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | dimethyl-[(1S)-2-[(4-nitrophenyl)carbamothioylamino]-1-thiophen-2-ylethyl]azanium |
| SMILES | C[NH+](C)[C@@H](CNC(=S)Nc1ccc([N+](=O)[O-])cc1)c1cccs1 |
| InChI | InChI=1S/C15H18N4O2S2/c1-18(2)13(14-4-3-9-23-14)10-16-15(22)17-11-5-7-12(8-6-11)19(20)21/h3-9,13H,10H2,1-2H3,(H2,16,17,22)/p+1/t13-/m0/s1 |
| InChIKey | IHCLFJPHXIXMJY-ZDUSSCGKSA-O |
| XLogP | 1.83 |
| TPSA | 71.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|