C17H24N3S2+ — CID 8684306
[(1R)-2-[(2,6-dimethylphenyl)carbamothioylamino]-1-thiophen-2-ylethyl]-dimethylazanium (PubChem CID 8684306) has the molecular formula C17H24N3S2+ and a molecular weight of 334.53 g/mol. Its IUPAC name is [(1R)-2-[(2,6-dimethylphenyl)carbamothioylamino]-1-thiophen-2-ylethyl]-dimethylazanium.
| Compound Name | [(1R)-2-[(2,6-dimethylphenyl)carbamothioylamino]-1-thiophen-2-ylethyl]-dimethylazanium |
|---|---|
| PubChem CID | 8684306 |
| Molecular Formula | C17H24N3S2+ |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | [(1R)-2-[(2,6-dimethylphenyl)carbamothioylamino]-1-thiophen-2-ylethyl]-dimethylazanium |
| SMILES | Cc1cccc(C)c1NC(=S)NC[C@H](c1cccs1)[NH+](C)C |
| InChI | InChI=1S/C17H23N3S2/c1-12-7-5-8-13(2)16(12)19-17(21)18-11-14(20(3)4)15-9-6-10-22-15/h5-10,14H,11H2,1-4H3,(H2,18,19,21)/p+1/t14-/m1/s1 |
| InChIKey | BDFGAEFMWQVWGV-CQSZACIVSA-O |
| XLogP | 2.54 |
| TPSA | 28.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|