C15H26N3S2+ — CID 7945287
[(1S)-2-(cyclohexylcarbamothioylamino)-1-thiophen-2-ylethyl]-dimethylazanium (PubChem CID 7945287) has the molecular formula C15H26N3S2+ and a molecular weight of 312.53 g/mol. Its IUPAC name is [(1S)-2-(cyclohexylcarbamothioylamino)-1-thiophen-2-ylethyl]-dimethylazanium.
| Compound Name | [(1S)-2-(cyclohexylcarbamothioylamino)-1-thiophen-2-ylethyl]-dimethylazanium |
|---|---|
| PubChem CID | 7945287 |
| Molecular Formula | C15H26N3S2+ |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | [(1S)-2-(cyclohexylcarbamothioylamino)-1-thiophen-2-ylethyl]-dimethylazanium |
| SMILES | C[NH+](C)[C@@H](CNC(=S)NC1CCCCC1)c1cccs1 |
| InChI | InChI=1S/C15H25N3S2/c1-18(2)13(14-9-6-10-20-14)11-16-15(19)17-12-7-4-3-5-8-12/h6,9-10,12-13H,3-5,7-8,11H2,1-2H3,(H2,16,17,19)/p+1/t13-/m0/s1 |
| InChIKey | RKBKDKXHNPSQTN-ZDUSSCGKSA-O |
| XLogP | 1.73 |
| TPSA | 28.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|