C19H28N3O3S+ — CID 11928742
[(1S)-2-[3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoylamino]-1-thiophen-2-ylethyl]-dimethylazanium (PubChem CID 11928742) has the molecular formula C19H28N3O3S+ and a molecular weight of 378.52 g/mol. Its IUPAC name is [(1S)-2-[3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoylamino]-1-thiophen-2-ylethyl]-dimethylazanium.
| Compound Name | [(1S)-2-[3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoylamino]-1-thiophen-2-ylethyl]-dimethylazanium |
|---|---|
| PubChem CID | 11928742 |
| Molecular Formula | C19H28N3O3S+ |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | [(1S)-2-[3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoylamino]-1-thiophen-2-ylethyl]-dimethylazanium |
| SMILES | C[NH+](C)[C@@H](CNC(=O)CCN1C(=O)[C@H]2CCCC[C@@H]2C1=O)c1cccs1 |
| InChI | InChI=1S/C19H27N3O3S/c1-21(2)15(16-8-5-11-26-16)12-20-17(23)9-10-22-18(24)13-6-3-4-7-14(13)19(22)25/h5,8,11,13-15H,3-4,6-7,9-10,12H2,1-2H3,(H,20,23)/p+1/t13-,14-,15-/m0/s1 |
| InChIKey | OORGUBBECUHKII-KKUMJFAQSA-O |
| XLogP | 0.62 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|