C21H29N3O4 — CID 11932186
3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]propanamide (PubChem CID 11932186) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is 3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]propanamide.
| Compound Name | 3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]propanamide |
|---|---|
| PubChem CID | 11932186 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]propanamide |
| SMILES | O=C(CCN1C(=O)[C@H]2CCCC[C@@H]2C1=O)NC[C@@H](c1ccco1)N1CCCC1 |
| InChI | InChI=1S/C21H29N3O4/c25-19(9-12-24-20(26)15-6-1-2-7-16(15)21(24)27)22-14-17(18-8-5-13-28-18)23-10-3-4-11-23/h5,8,13,15-17H,1-4,6-7,9-12,14H2,(H,22,25)/t15-,16-,17-/m0/s1 |
| InChIKey | IBRFLBSZPFHWTB-ULQDDVLXSA-N |
| XLogP | 2.10 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|