C22H24N2O4 — CID 8928284
3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(R)-furan-2-yl(phenyl)methyl]propanamide (PubChem CID 8928284) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(R)-furan-2-yl(phenyl)methyl]propanamide.
| Compound Name | 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(R)-furan-2-yl(phenyl)methyl]propanamide |
|---|---|
| PubChem CID | 8928284 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(R)-furan-2-yl(phenyl)methyl]propanamide |
| SMILES | O=C(CCN1C(=O)[C@H]2CCCC[C@H]2C1=O)N[C@H](c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C22H24N2O4/c25-19(12-13-24-21(26)16-9-4-5-10-17(16)22(24)27)23-20(18-11-6-14-28-18)15-7-2-1-3-8-15/h1-3,6-8,11,14,16-17,20H,4-5,9-10,12-13H2,(H,23,25)/t16-,17+,20-/m1/s1 |
| InChIKey | HPHLLNYEOUYQGK-FUHIMQAGSA-N |
| XLogP | 3.05 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|