C27H22N2O4 — CID 134029343
4-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-[furan-2-yl(phenyl)methyl]butanamide (PubChem CID 134029343) has the molecular formula C27H22N2O4 and a molecular weight of 438.48 g/mol. Its IUPAC name is 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-[furan-2-yl(phenyl)methyl]butanamide.
| Compound Name | 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-[furan-2-yl(phenyl)methyl]butanamide |
|---|---|
| PubChem CID | 134029343 |
| Molecular Formula | C27H22N2O4 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-[furan-2-yl(phenyl)methyl]butanamide |
| SMILES | O=C(CCCN1C(=O)c2cccc3cccc(c23)C1=O)NC(c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C27H22N2O4/c30-23(28-25(22-14-7-17-33-22)19-8-2-1-3-9-19)15-6-16-29-26(31)20-12-4-10-18-11-5-13-21(24(18)20)27(29)32/h1-5,7-14,17,25H,6,15-16H2,(H,28,30) |
| InChIKey | YQWLAOONLGIUDT-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|