C20H26N2O3 — CID 8912251
3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(2S)-2-phenylpropyl]propanamide (PubChem CID 8912251) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(2S)-2-phenylpropyl]propanamide.
| Compound Name | 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(2S)-2-phenylpropyl]propanamide |
|---|---|
| PubChem CID | 8912251 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(2S)-2-phenylpropyl]propanamide |
| SMILES | C[C@H](CNC(=O)CCN1C(=O)[C@H]2CCCC[C@H]2C1=O)c1ccccc1 |
| InChI | InChI=1S/C20H26N2O3/c1-14(15-7-3-2-4-8-15)13-21-18(23)11-12-22-19(24)16-9-5-6-10-17(16)20(22)25/h2-4,7-8,14,16-17H,5-6,9-13H2,1H3,(H,21,23)/t14-,16-,17+/m1/s1 |
| InChIKey | DTUWTQAYHIWRRV-OIISXLGYSA-N |
| XLogP | 2.47 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|