C22H31N3O4 — CID 11933481
3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(2R)-2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]propanamide (PubChem CID 11933481) has the molecular formula C22H31N3O4 and a molecular weight of 401.51 g/mol. Its IUPAC name is 3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(2R)-2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]propanamide.
| Compound Name | 3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(2R)-2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 11933481 |
| Molecular Formula | C22H31N3O4 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | 3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(2R)-2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]propanamide |
| SMILES | COc1cccc([C@H](CNC(=O)CCN2C(=O)[C@H]3CCCC[C@@H]3C2=O)N(C)C)c1 |
| InChI | InChI=1S/C22H31N3O4/c1-24(2)19(15-7-6-8-16(13-15)29-3)14-23-20(26)11-12-25-21(27)17-9-4-5-10-18(17)22(25)28/h6-8,13,17-19H,4-5,9-12,14H2,1-3H3,(H,23,26)/t17-,18-,19-/m0/s1 |
| InChIKey | WSNMBYPZNRRISD-FHWLQOOXSA-N |
| XLogP | 1.98 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|