C21H30N3O3+ — CID 8918866
[(1R)-2-[3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoylamino]-1-phenylethyl]-dimethylazanium (PubChem CID 8918866) has the molecular formula C21H30N3O3+ and a molecular weight of 372.49 g/mol. Its IUPAC name is [(1R)-2-[3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoylamino]-1-phenylethyl]-dimethylazanium.
| Compound Name | [(1R)-2-[3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoylamino]-1-phenylethyl]-dimethylazanium |
|---|---|
| PubChem CID | 8918866 |
| Molecular Formula | C21H30N3O3+ |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | [(1R)-2-[3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoylamino]-1-phenylethyl]-dimethylazanium |
| SMILES | C[NH+](C)[C@@H](CNC(=O)CCN1C(=O)[C@H]2CCCC[C@H]2C1=O)c1ccccc1 |
| InChI | InChI=1S/C21H29N3O3/c1-23(2)18(15-8-4-3-5-9-15)14-22-19(25)12-13-24-20(26)16-10-6-7-11-17(16)21(24)27/h3-5,8-9,16-18H,6-7,10-14H2,1-2H3,(H,22,25)/p+1/t16-,17+,18-/m0/s1 |
| InChIKey | WEIOWKFIXCOMGF-KSZLIROESA-O |
| XLogP | 0.55 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|