C18H26N3O4+ — CID 2532602
[(1S)-2-[[2-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetyl]amino]-1-(furan-2-yl)ethyl]-dimethylazanium (PubChem CID 2532602) has the molecular formula C18H26N3O4+ and a molecular weight of 348.42 g/mol. Its IUPAC name is [(1S)-2-[[2-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetyl]amino]-1-(furan-2-yl)ethyl]-dimethylazanium.
| Compound Name | [(1S)-2-[[2-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetyl]amino]-1-(furan-2-yl)ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 2532602 |
| Molecular Formula | C18H26N3O4+ |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | [(1S)-2-[[2-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetyl]amino]-1-(furan-2-yl)ethyl]-dimethylazanium |
| SMILES | C[NH+](C)[C@@H](CNC(=O)CN1C(=O)[C@H]2CCCC[C@H]2C1=O)c1ccco1 |
| InChI | InChI=1S/C18H25N3O4/c1-20(2)14(15-8-5-9-25-15)10-19-16(22)11-21-17(23)12-6-3-4-7-13(12)18(21)24/h5,8-9,12-14H,3-4,6-7,10-11H2,1-2H3,(H,19,22)/p+1/t12-,13+,14-/m0/s1 |
| InChIKey | DDVNKJUABRAAKQ-MJBXVCDLSA-O |
| XLogP | -0.24 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|