C21H33N4O4+ — CID 8008658
[(1S)-1-(furan-2-yl)-2-[[2-[(5S,9S)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetyl]amino]ethyl]-dimethylazanium (PubChem CID 8008658) has the molecular formula C21H33N4O4+ and a molecular weight of 405.52 g/mol. Its IUPAC name is [(1S)-1-(furan-2-yl)-2-[[2-[(5S,9S)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetyl]amino]ethyl]-dimethylazanium.
| Compound Name | [(1S)-1-(furan-2-yl)-2-[[2-[(5S,9S)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetyl]amino]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 8008658 |
| Molecular Formula | C21H33N4O4+ |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | [(1S)-1-(furan-2-yl)-2-[[2-[(5S,9S)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetyl]amino]ethyl]-dimethylazanium |
| SMILES | C[C@H]1CC(C)(C)C[C@]2(C1)NC(=O)N(CC(=O)NC[C@@H](c1ccco1)[NH+](C)C)C2=O |
| InChI | InChI=1S/C21H32N4O4/c1-14-9-20(2,3)13-21(10-14)18(27)25(19(28)23-21)12-17(26)22-11-15(24(4)5)16-7-6-8-29-16/h6-8,14-15H,9-13H2,1-5H3,(H,22,26)(H,23,28)/p+1/t14-,15-,21-/m0/s1 |
| InChIKey | NNRSXFOCZRKHNK-GXZWQRSESA-O |
| XLogP | 0.72 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|