C23H34N3O3+ — CID 11933492
[(1S)-2-[3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoylamino]-1-(4-ethylphenyl)ethyl]-dimethylazanium (PubChem CID 11933492) has the molecular formula C23H34N3O3+ and a molecular weight of 400.54 g/mol. Its IUPAC name is [(1S)-2-[3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoylamino]-1-(4-ethylphenyl)ethyl]-dimethylazanium.
| Compound Name | [(1S)-2-[3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoylamino]-1-(4-ethylphenyl)ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 11933492 |
| Molecular Formula | C23H34N3O3+ |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | [(1S)-2-[3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoylamino]-1-(4-ethylphenyl)ethyl]-dimethylazanium |
| SMILES | CCc1ccc([C@@H](CNC(=O)CCN2C(=O)[C@H]3CCCC[C@@H]3C2=O)[NH+](C)C)cc1 |
| InChI | InChI=1S/C23H33N3O3/c1-4-16-9-11-17(12-10-16)20(25(2)3)15-24-21(27)13-14-26-22(28)18-7-5-6-8-19(18)23(26)29/h9-12,18-20H,4-8,13-15H2,1-3H3,(H,24,27)/p+1/t18-,19-,20+/m0/s1 |
| InChIKey | IFMATSQASQRFHR-SLFFLAALSA-O |
| XLogP | 1.12 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|