C19H30N2O4S — CID 51953240
3-cyclopentylsulfonyl-N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ylethyl]propanamide (PubChem CID 51953240) has the molecular formula C19H30N2O4S and a molecular weight of 382.53 g/mol. Its IUPAC name is 3-cyclopentylsulfonyl-N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ylethyl]propanamide.
| Compound Name | 3-cyclopentylsulfonyl-N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ylethyl]propanamide |
|---|---|
| PubChem CID | 51953240 |
| Molecular Formula | C19H30N2O4S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 3-cyclopentylsulfonyl-N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ylethyl]propanamide |
| SMILES | O=C(CCS(=O)(=O)C1CCCC1)NC[C@H](c1ccco1)N1CCCCC1 |
| InChI | InChI=1S/C19H30N2O4S/c22-19(10-14-26(23,24)16-7-2-3-8-16)20-15-17(18-9-6-13-25-18)21-11-4-1-5-12-21/h6,9,13,16-17H,1-5,7-8,10-12,14-15H2,(H,20,22)/t17-/m1/s1 |
| InChIKey | DAXYVNBMUZDRGV-QGZVFWFLSA-N |
| XLogP | 2.67 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |