C19H22N3O3S+ — CID 8504381
[(1R)-2-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]-1-thiophen-2-ylethyl]-dimethylazanium (PubChem CID 8504381) has the molecular formula C19H22N3O3S+ and a molecular weight of 372.47 g/mol. Its IUPAC name is [(1R)-2-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]-1-thiophen-2-ylethyl]-dimethylazanium.
| Compound Name | [(1R)-2-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]-1-thiophen-2-ylethyl]-dimethylazanium |
|---|---|
| PubChem CID | 8504381 |
| Molecular Formula | C19H22N3O3S+ |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | [(1R)-2-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]-1-thiophen-2-ylethyl]-dimethylazanium |
| SMILES | C[NH+](C)[C@H](CNC(=O)CCN1C(=O)c2ccccc2C1=O)c1cccs1 |
| InChI | InChI=1S/C19H21N3O3S/c1-21(2)15(16-8-5-11-26-16)12-20-17(23)9-10-22-18(24)13-6-3-4-7-14(13)19(22)25/h3-8,11,15H,9-10,12H2,1-2H3,(H,20,23)/p+1/t15-/m1/s1 |
| InChIKey | NESAXZUVHLOQKX-OAHLLOKOSA-O |
| XLogP | 0.74 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|