C21H20N4O3S — CID 122265180
4-(1,3-dioxoisoindol-2-yl)-N-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)butanamide (PubChem CID 122265180) has the molecular formula C21H20N4O3S and a molecular weight of 408.48 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-N-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)butanamide.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-N-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)butanamide |
|---|---|
| PubChem CID | 122265180 |
| Molecular Formula | C21H20N4O3S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-N-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)butanamide |
| SMILES | O=C(CCCN1C(=O)c2ccccc2C1=O)NCC(c1cccs1)n1cccn1 |
| InChI | InChI=1S/C21H20N4O3S/c26-19(22-14-17(18-8-4-13-29-18)25-12-5-10-23-25)9-3-11-24-20(27)15-6-1-2-7-16(15)21(24)28/h1-2,4-8,10,12-13,17H,3,9,11,14H2,(H,22,26) |
| InChIKey | FSVWRUMWBGFSOR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|