C18H19N3OS2 — CID 122265128
3-phenylsulfanyl-N-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)propanamide (PubChem CID 122265128) has the molecular formula C18H19N3OS2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 3-phenylsulfanyl-N-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)propanamide.
| Compound Name | 3-phenylsulfanyl-N-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)propanamide |
|---|---|
| PubChem CID | 122265128 |
| Molecular Formula | C18H19N3OS2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 3-phenylsulfanyl-N-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)propanamide |
| SMILES | O=C(CCSc1ccccc1)NCC(c1cccs1)n1cccn1 |
| InChI | InChI=1S/C18H19N3OS2/c22-18(9-13-23-15-6-2-1-3-7-15)19-14-16(17-8-4-12-24-17)21-11-5-10-20-21/h1-8,10-12,16H,9,13-14H2,(H,19,22) |
| InChIKey | WHGWTDROLJEFIQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |