C11H13N3O2S — CID 122265033
methyl N-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)carbamate (PubChem CID 122265033) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is methyl N-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)carbamate.
| Compound Name | methyl N-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)carbamate |
|---|---|
| PubChem CID | 122265033 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | methyl N-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)carbamate |
| SMILES | COC(=O)NCC(c1cccs1)n1cccn1 |
| InChI | InChI=1S/C11H13N3O2S/c1-16-11(15)12-8-9(10-4-2-7-17-10)14-6-3-5-13-14/h2-7,9H,8H2,1H3,(H,12,15) |
| InChIKey | JDXUIUUWNKISAM-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |