C16H14FN3OS — CID 122265055
2-fluoro-N-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)benzamide (PubChem CID 122265055) has the molecular formula C16H14FN3OS and a molecular weight of 315.37 g/mol. Its IUPAC name is 2-fluoro-N-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)benzamide.
| Compound Name | 2-fluoro-N-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 122265055 |
| Molecular Formula | C16H14FN3OS |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 2-fluoro-N-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)benzamide |
| SMILES | O=C(NCC(c1cccs1)n1cccn1)c1ccccc1F |
| InChI | InChI=1S/C16H14FN3OS/c17-13-6-2-1-5-12(13)16(21)18-11-14(15-7-3-10-22-15)20-9-4-8-19-20/h1-10,14H,11H2,(H,18,21) |
| InChIKey | UVFZMKLQEUPVLD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |