C16H15FN4OS — CID 122265442
1-(4-fluorophenyl)-3-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)urea (PubChem CID 122265442) has the molecular formula C16H15FN4OS and a molecular weight of 330.39 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)urea.
| Compound Name | 1-(4-fluorophenyl)-3-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)urea |
|---|---|
| PubChem CID | 122265442 |
| Molecular Formula | C16H15FN4OS |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 1-(4-fluorophenyl)-3-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)urea |
| SMILES | O=C(NCC(c1cccs1)n1cccn1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C16H15FN4OS/c17-12-4-6-13(7-5-12)20-16(22)18-11-14(15-3-1-10-23-15)21-9-2-8-19-21/h1-10,14H,11H2,(H2,18,20,22) |
| InChIKey | BFQRHLHNQLXIBX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |