C16H15N5O2S — CID 122265357
N-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)-N'-pyridin-3-yloxamide (PubChem CID 122265357) has the molecular formula C16H15N5O2S and a molecular weight of 341.40 g/mol. Its IUPAC name is N-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)-N'-pyridin-3-yloxamide.
| Compound Name | N-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)-N'-pyridin-3-yloxamide |
|---|---|
| PubChem CID | 122265357 |
| Molecular Formula | C16H15N5O2S |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | N-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)-N'-pyridin-3-yloxamide |
| SMILES | O=C(NCC(c1cccs1)n1cccn1)C(=O)Nc1cccnc1 |
| InChI | InChI=1S/C16H15N5O2S/c22-15(16(23)20-12-4-1-6-17-10-12)18-11-13(14-5-2-9-24-14)21-8-3-7-19-21/h1-10,13H,11H2,(H,18,22)(H,20,23) |
| InChIKey | MVHRNXYKDMHOMQ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|