C14H18N4O3S — CID 122265353
N-(2-methoxyethyl)-N'-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)oxamide (PubChem CID 122265353) has the molecular formula C14H18N4O3S and a molecular weight of 322.39 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N'-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)oxamide.
| Compound Name | N-(2-methoxyethyl)-N'-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)oxamide |
|---|---|
| PubChem CID | 122265353 |
| Molecular Formula | C14H18N4O3S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | N-(2-methoxyethyl)-N'-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)oxamide |
| SMILES | COCCNC(=O)C(=O)NCC(c1cccs1)n1cccn1 |
| InChI | InChI=1S/C14H18N4O3S/c1-21-8-6-15-13(19)14(20)16-10-11(12-4-2-9-22-12)18-7-3-5-17-18/h2-5,7,9,11H,6,8,10H2,1H3,(H,15,19)(H,16,20) |
| InChIKey | JAMVUILNRIGDKL-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|