C17H16FN3O2S — CID 122265100
2-(2-fluorophenoxy)-N-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)acetamide (PubChem CID 122265100) has the molecular formula C17H16FN3O2S and a molecular weight of 345.40 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)-N-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-(2-fluorophenoxy)-N-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 122265100 |
| Molecular Formula | C17H16FN3O2S |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 2-(2-fluorophenoxy)-N-(2-pyrazol-1-yl-2-thiophen-2-ylethyl)acetamide |
| SMILES | O=C(COc1ccccc1F)NCC(c1cccs1)n1cccn1 |
| InChI | InChI=1S/C17H16FN3O2S/c18-13-5-1-2-6-15(13)23-12-17(22)19-11-14(16-7-3-10-24-16)21-9-4-8-20-21/h1-10,14H,11-12H2,(H,19,22) |
| InChIKey | PLYVBRUBOFXWGQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |