C22H24BrN3O3S — CID 46522651
4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)butanamide (PubChem CID 46522651) has the molecular formula C22H24BrN3O3S and a molecular weight of 490.42 g/mol. Its IUPAC name is 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)butanamide.
| Compound Name | 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)butanamide |
|---|---|
| PubChem CID | 46522651 |
| Molecular Formula | C22H24BrN3O3S |
| Molecular Weight | 490.42 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)butanamide |
| SMILES | O=C(CCCN1C(=O)c2ccc(Br)cc2C1=O)NCC(c1cccs1)N1CCCC1 |
| InChI | InChI=1S/C22H24BrN3O3S/c23-15-7-8-16-17(13-15)22(29)26(21(16)28)11-3-6-20(27)24-14-18(19-5-4-12-30-19)25-9-1-2-10-25/h4-5,7-8,12-13,18H,1-3,6,9-11,14H2,(H,24,27) |
| InChIKey | NAIFKIGIWMCTGJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|