C19H22BrN3O2S — CID 55378248
3-bromo-N-[2-oxo-2-[(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)amino]ethyl]benzamide (PubChem CID 55378248) has the molecular formula C19H22BrN3O2S and a molecular weight of 436.38 g/mol. Its IUPAC name is 3-bromo-N-[2-oxo-2-[(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)amino]ethyl]benzamide.
| Compound Name | 3-bromo-N-[2-oxo-2-[(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 55378248 |
| Molecular Formula | C19H22BrN3O2S |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | 3-bromo-N-[2-oxo-2-[(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)amino]ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1cccc(Br)c1)NCC(c1cccs1)N1CCCC1 |
| InChI | InChI=1S/C19H22BrN3O2S/c20-15-6-3-5-14(11-15)19(25)22-13-18(24)21-12-16(17-7-4-10-26-17)23-8-1-2-9-23/h3-7,10-11,16H,1-2,8-9,12-13H2,(H,21,24)(H,22,25) |
| InChIKey | QMWRWJIPGSXBLK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |