C16H20BrN3O3 — CID 119434052
4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[3-(methylamino)propyl]butanamide (PubChem CID 119434052) has the molecular formula C16H20BrN3O3 and a molecular weight of 382.26 g/mol. Its IUPAC name is 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[3-(methylamino)propyl]butanamide.
| Compound Name | 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[3-(methylamino)propyl]butanamide |
|---|---|
| PubChem CID | 119434052 |
| Molecular Formula | C16H20BrN3O3 |
| Molecular Weight | 382.26 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[3-(methylamino)propyl]butanamide |
| SMILES | CNCCCNC(=O)CCCN1C(=O)c2ccc(Br)cc2C1=O |
| InChI | InChI=1S/C16H20BrN3O3/c1-18-7-3-8-19-14(21)4-2-9-20-15(22)12-6-5-11(17)10-13(12)16(20)23/h5-6,10,18H,2-4,7-9H2,1H3,(H,19,21) |
| InChIKey | NPPWVVSZJQGZAI-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.26 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|