C19H25BrN2O4 — CID 27682905
4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-(3-butoxypropyl)butanamide (PubChem CID 27682905) has the molecular formula C19H25BrN2O4 and a molecular weight of 425.32 g/mol. Its IUPAC name is 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-(3-butoxypropyl)butanamide.
| Compound Name | 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-(3-butoxypropyl)butanamide |
|---|---|
| PubChem CID | 27682905 |
| Molecular Formula | C19H25BrN2O4 |
| Molecular Weight | 425.32 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-(3-butoxypropyl)butanamide |
| SMILES | CCCCOCCCNC(=O)CCCN1C(=O)c2ccc(Br)cc2C1=O |
| InChI | InChI=1S/C19H25BrN2O4/c1-2-3-11-26-12-5-9-21-17(23)6-4-10-22-18(24)15-8-7-14(20)13-16(15)19(22)25/h7-8,13H,2-6,9-12H2,1H3,(H,21,23) |
| InChIKey | LZEWZIWZRHMZMC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|