C20H28BrN3O3 — CID 39467985
4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[2-[di(propan-2-yl)amino]ethyl]butanamide (PubChem CID 39467985) has the molecular formula C20H28BrN3O3 and a molecular weight of 438.37 g/mol. Its IUPAC name is 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[2-[di(propan-2-yl)amino]ethyl]butanamide.
| Compound Name | 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[2-[di(propan-2-yl)amino]ethyl]butanamide |
|---|---|
| PubChem CID | 39467985 |
| Molecular Formula | C20H28BrN3O3 |
| Molecular Weight | 438.37 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[2-[di(propan-2-yl)amino]ethyl]butanamide |
| SMILES | CC(C)N(CCNC(=O)CCCN1C(=O)c2ccc(Br)cc2C1=O)C(C)C |
| InChI | InChI=1S/C20H28BrN3O3/c1-13(2)23(14(3)4)11-9-22-18(25)6-5-10-24-19(26)16-8-7-15(21)12-17(16)20(24)27/h7-8,12-14H,5-6,9-11H2,1-4H3,(H,22,25) |
| InChIKey | MFJVQDKZVDKRKG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|