C21H19BrF2N2O4 — CID 55385257
4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[2-[4-(difluoromethoxy)phenyl]ethyl]butanamide (PubChem CID 55385257) has the molecular formula C21H19BrF2N2O4 and a molecular weight of 481.29 g/mol. Its IUPAC name is 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[2-[4-(difluoromethoxy)phenyl]ethyl]butanamide.
| Compound Name | 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[2-[4-(difluoromethoxy)phenyl]ethyl]butanamide |
|---|---|
| PubChem CID | 55385257 |
| Molecular Formula | C21H19BrF2N2O4 |
| Molecular Weight | 481.29 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[2-[4-(difluoromethoxy)phenyl]ethyl]butanamide |
| SMILES | O=C(CCCN1C(=O)c2ccc(Br)cc2C1=O)NCCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C21H19BrF2N2O4/c22-14-5-8-16-17(12-14)20(29)26(19(16)28)11-1-2-18(27)25-10-9-13-3-6-15(7-4-13)30-21(23)24/h3-8,12,21H,1-2,9-11H2,(H,25,27) |
| InChIKey | YCJFMSGZLZVYHU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.29 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|