C23H20N2O3S — CID 8854781
3-(1,3-dioxoisoindol-2-yl)-N-[(S)-(4-methylphenyl)-thiophen-2-ylmethyl]propanamide (PubChem CID 8854781) has the molecular formula C23H20N2O3S and a molecular weight of 404.49 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-[(S)-(4-methylphenyl)-thiophen-2-ylmethyl]propanamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-[(S)-(4-methylphenyl)-thiophen-2-ylmethyl]propanamide |
|---|---|
| PubChem CID | 8854781 |
| Molecular Formula | C23H20N2O3S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-[(S)-(4-methylphenyl)-thiophen-2-ylmethyl]propanamide |
| SMILES | Cc1ccc([C@H](NC(=O)CCN2C(=O)c3ccccc3C2=O)c2cccs2)cc1 |
| InChI | InChI=1S/C23H20N2O3S/c1-15-8-10-16(11-9-15)21(19-7-4-14-29-19)24-20(26)12-13-25-22(27)17-5-2-3-6-18(17)23(25)28/h2-11,14,21H,12-13H2,1H3,(H,24,26)/t21-/m0/s1 |
| InChIKey | SZEXNZBVDZOQAR-NRFANRHFSA-N |
| XLogP | 3.95 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|