C22H20N2O2S — CID 8866970
2-[2-[[(R)-(4-methylphenyl)-thiophen-2-ylmethyl]amino]ethyl]isoindole-1,3-dione (PubChem CID 8866970) has the molecular formula C22H20N2O2S and a molecular weight of 376.48 g/mol. Its IUPAC name is 2-[2-[[(R)-(4-methylphenyl)-thiophen-2-ylmethyl]amino]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[[(R)-(4-methylphenyl)-thiophen-2-ylmethyl]amino]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 8866970 |
| Molecular Formula | C22H20N2O2S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 2-[2-[[(R)-(4-methylphenyl)-thiophen-2-ylmethyl]amino]ethyl]isoindole-1,3-dione |
| SMILES | Cc1ccc([C@@H](NCCN2C(=O)c3ccccc3C2=O)c2cccs2)cc1 |
| InChI | InChI=1S/C22H20N2O2S/c1-15-8-10-16(11-9-15)20(19-7-4-14-27-19)23-12-13-24-21(25)17-5-2-3-6-18(17)22(24)26/h2-11,14,20,23H,12-13H2,1H3/t20-/m1/s1 |
| InChIKey | FKVJFZAJPXKSMB-HXUWFJFHSA-N |
| XLogP | 4.03 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|